* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WYE 687 DIHYDROCHLORIDE |
CAS: | 1062161-90-3 |
EnglishSynonyms: | WYE 687 DIHYDROCHLORIDE |
pro_mdlNumber: | MFCD22683807 |
pro_acceptors: | 11 |
pro_donors: | 1 |
pro_smile: | COC(=O)Nc1ccc(cc1)c2nc3c(cnn3C4CCN(CC4)Cc5cccnc5)c(n2)N6CCOCC6.Cl.Cl |
InChi: | InChI=1S/C28H32N8O3.2ClH/c1-38-28(37)31-22-6-4-21(5-7-22)25-32-26(35-13-15-39-16-14-35)24-18-30-36(27(24)33-25)23-8-11-34(12-9-23)19-20-3-2-10-29-17-20;;/h2-7,10,17-18,23H,8-9,11-16,19H2,1H3,(H,31,37);2*1H |
InChiKey: | InChIKey=ZQJPHAXLAKKXIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.