* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PENTANOIC ACID, 4-CHLORO-, ETHYL ESTER, (R)- |
| CAS: | 41869-16-3 |
| EnglishSynonyms: | PENTANOIC ACID, 4-CHLORO-, ETHYL ESTER, (R)- |
| pro_mdlNumber: | MFCD12912687 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCOC(=O)CC[C@@H](C)Cl |
| InChi: | InChI=1S/C7H13ClO2/c1-3-10-7(9)5-4-6(2)8/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChiKey: | InChIKey=OJAYUEGXOWQYTB-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.