* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WAY 267464 DIHYDROCHLORIDE |
CAS: | 847375-16-0 |
EnglishSynonyms: | WAY 267464 DIHYDROCHLORIDE |
pro_mdlNumber: | MFCD19690923 |
pro_acceptors: | 11 |
pro_donors: | 4 |
pro_smile: | Cc1cc(ccc1CNC(=O)N2CCN(CC2)Cc3cc(cc(c3)O)O)C(=O)N4Cc5cnn(c5Nc6c4cccc6)C.Cl.Cl |
InChi: | InChI=1S/C32H35N7O4.2ClH/c1-21-13-23(31(42)39-20-25-18-34-36(2)30(25)35-28-5-3-4-6-29(28)39)7-8-24(21)17-33-32(43)38-11-9-37(10-12-38)19-22-14-26(40)16-27(41)15-22;;/h3-8,13-16,18,35,40-41H,9-12,17,19-20H2,1-2H3,(H,33,43);2*1H |
InChiKey: | InChIKey=OTFWXMFLPMUDFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.