* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHANONE, 1-(1H-INDOL-5-YL)-, OXIME |
| CAS: | 103039-17-4 |
| EnglishSynonyms: | ETHANONE, 1-(1H-INDOL-5-YL)-, OXIME |
| pro_mdlNumber: | MFCD03004851 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | C/C(=N\O)/c1ccc2c(c1)cc[nH]2 |
| InChi: | InChI=1S/C10H10N2O/c1-7(12-13)8-2-3-10-9(6-8)4-5-11-10/h2-6,11,13H,1H3/b12-7+ |
| InChiKey: | InChIKey=OVIMWMKWQSVUSE-KPKJPENVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.