* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | H-TYR-TYR-OH |
| CAS: | 1050-28-8 |
| EnglishSynonyms: | TYR-TYR ; H-TYR-TYR-OH ; L-TYROSYL-L-TYROSINE |
| pro_mdlNumber: | MFCD00063044 |
| pro_acceptors: | 7 |
| pro_donors: | 5 |
| pro_smile: | c1cc(ccc1C[C@@H](C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)O)N)O |
| InChi: | InChI=1S/C18H20N2O5/c19-15(9-11-1-5-13(21)6-2-11)17(23)20-16(18(24)25)10-12-3-7-14(22)8-4-12/h1-8,15-16,21-22H,9-10,19H2,(H,20,23)(H,24,25)/t15-,16-/m0/s1 |
| InChiKey: | InChIKey=JAQGKXUEKGKTKX-HOTGVXAUSA-N |
|
|
| Comments: | CRYSTALLINE |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.