* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-MENTHYL ACRYLATE |
| CAS: | 108945-28-4 |
| EnglishSynonyms: | D-MENTHYL ACRYLATE |
| pro_mdlNumber: | MFCD00080538 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)C=C)C(C)C |
| InChi: | InChI=1S/C13H22O2/c1-5-13(14)15-12-8-10(4)6-7-11(12)9(2)3/h5,9-12H,1,6-8H2,2-4H3/t10-,11+,12-/m0/s1 |
| InChiKey: | InChIKey=XJBRSZAYOKVFRH-TUAOUCFPSA-N |
|
|
| MeltingPoint: | MP 26 |
| Boiling_Point: | BP 173 (5 MM HG) |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.