* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | DIETHYL MALEATE-1,4-13C2 |
CAS: | 1173097-75-0 |
EnglishSynonyms: | DIETHYL MALEATE-1,4-13C2 |
pro_mdlNumber: | MFCD10566946 |
pro_acceptors: | 4 |
pro_donors: | 0 |
pro_smile: | CCO[13C](=O)/C=C\[13C](=O)OCC |
InChi: | InChI=1S/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5-/i7+1,8+1 |
InChiKey: | InChIKey=IEPRKVQEAMIZSS-PAIDASCPSA-N |
property |
|
MeltingPoint: | -10 DEG C |
Boiling_Point: | 225 DEG C |
Density: | DENSITY: 1.076 G/ML AT 25 DEG C |
PhysicalProperty: | FLASHPOINT: 197.6 DEG F FLASHPOINT: 92 DEG C |
Comments: | MASS SHIFT: M+2 WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 174.16 BY ATOM % CALCULATION |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.