* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FMOC-3-AMINOADIPIC ACID |
| CAS: | 1185303-08-5 |
| EnglishSynonyms: | FMOC-3-AMINOADIPIC ACID |
| pro_mdlNumber: | MFCD02682492 |
| pro_acceptors: | 7 |
| pro_donors: | 3 |
| pro_smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)NC(CCC(=O)O)CC(=O)O |
| InChi: | InChI=1S/C21H21NO6/c23-19(24)10-9-13(11-20(25)26)22-21(27)28-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12H2,(H,22,27)(H,23,24)(H,25,26) |
| InChiKey: | InChIKey=JJSUQIKTDAOMSC-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.