* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | VU 0364739 HYDROCHLORIDE |
| CAS: | 1244639-78-8 |
| EnglishSynonyms: | VU 0364739 HYDROCHLORIDE |
| pro_mdlNumber: | MFCD19690943 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | c1ccc2cc(ccc2c1)C(=O)NCCN3CCC4(CC3)C(=O)NCN4c5cccc(c5)F.Cl |
| InChi: | InChI=1S/C26H27FN4O2.ClH/c27-22-6-3-7-23(17-22)31-18-29-25(33)26(31)10-13-30(14-11-26)15-12-28-24(32)21-9-8-19-4-1-2-5-20(19)16-21;/h1-9,16-17H,10-15,18H2,(H,28,32)(H,29,33);1H |
| InChiKey: | InChIKey=RYLAMDMOILNBKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.