* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DL-ASPARTIC ACID-2,3,3-D3 |
| CAS: | 14341-75-4 |
| EnglishSynonyms: | DL-ASPARTIC-2,3,3-D3 ACID ; DL-ASPARTIC ACID-2,3,3-D3 |
| pro_mdlNumber: | MFCD00144167 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | [2H]C([2H])(C(=O)O)C([2H])(C(=O)O)N |
| InChiKey: | InChIKey=null |
|
|
| MeltingPoint: | >300 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+3 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 136.07 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.