* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | QUINOLINE, 4,8-DINITRO-, 1-OXIDE |
| CAS: | 14753-19-6 |
| EnglishSynonyms: | QUINOLINE, 4,8-DINITRO-, 1-OXIDE |
| pro_mdlNumber: | MFCD01685490 |
| pro_acceptors: | 8 |
| pro_donors: | 0 |
| pro_smile: | c1cc2c(cc[n+](c2c(c1)[N+](=O)[O-])[O-])[N+](=O)[O-] |
| InChi: | InChI=1S/C9H5N3O5/c13-10-5-4-7(11(14)15)6-2-1-3-8(9(6)10)12(16)17/h1-5H |
| InChiKey: | InChIKey=VTEYIVXQGGFQFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.