* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | BENZENE-1,2,4,5-D4 |
| CAS: | 14919-17-6 ;14941-52-7 |
| EnglishSynonyms: | BENZENE-1,2,4,5-D4 ; BENZENE-1,2,3,5-D4 |
| pro_mdlNumber: | MFCD01075474 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | [2H]c1cc(c(cc1[2H])[2H])[2H] |
| InChiKey: | InChIKey=null |
|
|
| MeltingPoint: | 5.5 DEG C(LIT) |
| Boiling_Point: | 80 DEG C(LIT) |
| Density: | DENSITY: 0.919 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: -11 DEG C FLASHPOINT: 12.2 DEG F |
| Comments: | MASS SHIFT: M+4 RIDADR: UN 1114 3/PG 2 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % D MW: 82.10 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.