* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3-DIETHYL-8-(2-(4-HYDROXYPHENYL)ETH ENYL)-7-METHYL-, (E)- |
| CAS: | 155272-05-2 |
| EnglishSynonyms: | 1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3-DIETHYL-8-(2-(4-HYDROXYPHENYL)ETH ENYL)-7-METHYL-, (E)- |
| pro_mdlNumber: | MFCD01757826 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CCn1c2c(c(=O)n(c1=O)CC)n(c(n2)/C=C/c3ccc(cc3)O)C |
| InChi: | InChI=1S/C18H20N4O3/c1-4-21-16-15(17(24)22(5-2)18(21)25)20(3)14(19-16)11-8-12-6-9-13(23)10-7-12/h6-11,23H,4-5H2,1-3H3/b11-8+ |
| InChiKey: | InChIKey=KHQLNJCUEMABBR-DHZHZOJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.