* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 1H-Indole-1-acetic acid, 6-methoxy- |
CAS: | 1554781-14-4 |
EnglishSynonyms: | 1H-INDOLE-1-ACETIC ACID, 6-METHOXY- |
pro_acceptors: | 0 |
pro_donors: | 0 |
pro_smile: | COC1=CC=C2C=CN(C2=C1)CC(=O)O |
InChi: | InChI=1S/C11H11NO3/c1-15-9-3-2-8-4-5-12(7-11(13)14)10(8)6-9/h2-6H,7H2,1H3,(H,13,14) |
InChiKey: | InChIKey=NGJSYQCLFFPIGN-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.