* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | CHLOROACETYL CHLORIDE-1-13C |
| CAS: | 159301-42-5 |
| EnglishSynonyms: | CHLOROACETYL CHLORIDE-1-13C |
| pro_mdlNumber: | MFCD00083921 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | C([13C](=O)Cl)Cl |
| InChi: | InChI=1S/C2H2Cl2O/c3-1-2(4)5/h1H2/i2+1 |
| InChiKey: | InChIKey=VGCXGMAHQTYDJK-VQEHIDDOSA-N |
|
|
| MeltingPoint: | -22 DEG C(LIT) |
| Boiling_Point: | 105-106 DEG C(LIT) |
| Density: | DENSITY: 1.430 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: 100 DEG C FLASHPOINT: 212 DEG F REFRACTIVE INDEX: N20/D 1.453(LIT) |
| Comments: | MASS SHIFT: M+1 RIDADR: UN 1752 6.1/PG 1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 113.93 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.