* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | Q 8 2-HYDROXY-3-(2-NAPHTHYL)-1,4-NAPHTHOQUINONE |
CAS: | 18100-07-7 |
EnglishSynonyms: | Q 8 2-HYDROXY-3-(2-NAPHTHYL)-1,4-NAPHTHOQUINONE |
pro_mdlNumber: | MFCD00019551 |
pro_acceptors: | 3 |
pro_donors: | 1 |
pro_smile: | c1ccc2cc(ccc2c1)C3=C(C(=O)c4ccccc4C3=O)O |
InChi: | InChI=1S/C20H12O3/c21-18-15-7-3-4-8-16(15)19(22)20(23)17(18)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,23H |
InChiKey: | InChIKey=UGWTZLPWSHRLAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.