* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | R 115866 |
CAS: | 201410-53-9 |
EnglishSynonyms: | R 115866 ; TALAROZOLE |
pro_mdlNumber: | MFCD17166995 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CCC(CC)C(c1ccc(cc1)Nc2nc3ccccc3s2)n4cncn4 |
InChi: | InChI=1S/C21H23N5S/c1-3-15(4-2)20(26-14-22-13-23-26)16-9-11-17(12-10-16)24-21-25-18-7-5-6-8-19(18)27-21/h5-15,20H,3-4H2,1-2H3,(H,24,25) |
InChiKey: | InChIKey=SNFYYXUGUBUECJ-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.