* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ICRF-193 |
| CAS: | 21416-68-2 ;21416-88-6 |
| EnglishSynonyms: | ICRF-193 ; MESO-4,4'-(3,2-BUTANEDIYL)-BIS(2,6-PIPERAZINEDIONE) |
| pro_mdlNumber: | MFCD01702964 |
| pro_acceptors: | 8 |
| pro_donors: | 2 |
| pro_smile: | C[C@H]([C@H](C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
| InChi: | InChI=1S/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)/t7-,8+ |
| InChiKey: | InChIKey=OBYGAPWKTPDTAS-OCAPTIKFSA-N |
|
|
|
|
| secure_symbol: |
GHS06
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H317 |
| secure_cautionary_stmt: | P280-P301 + P310 |
| secure_damage_code: | Xn |
| secure_risk_disclosure_stmt: | R:22-43 |
| secure_security_stmt: | S:36/37 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.