* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9,10-DIMETHOXY-ANTHRACENE |
| CAS: | 2395-97-3 |
| EnglishSynonyms: | RARECHEM AQ BD AN05 ; 9,10-DIMETHOXY-ANTHRACENE |
| pro_mdlNumber: | MFCD00034636 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | COc1c2ccccc2c(c3c1cccc3)OC |
| InChi: | InChI=1S/C16H14O2/c1-17-15-11-7-3-5-9-13(11)16(18-2)14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| InChiKey: | InChIKey=JWJMBKSFTTXMLL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.