* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 4-PHENOXY-2-(2-PROPEN-1-YL)-PHENOL |
CAS: | 25345-77-1 |
EnglishSynonyms: | 4-PHENOXY-2-(PROP-2-EN-1-YL)PHENOL ; 4-PHENOXY-2-(2-PROPEN-1-YL)-PHENOL ; PHENOL, 4-PHENOXY-2-(2-PROPEN-1-YL)- |
pro_mdlNumber: | MFCD17015678 |
pro_acceptors: | 2 |
pro_donors: | 1 |
pro_smile: | C=CCc1cc(ccc1O)Oc2ccccc2 |
InChi: | InChI=1S/C15H14O2/c1-2-6-12-11-14(9-10-15(12)16)17-13-7-4-3-5-8-13/h2-5,7-11,16H,1,6H2 |
InChiKey: | InChIKey=GWGRYISDTOTBAH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.