* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3(2H)-PYRIDAZINONE, 4,6-DICHLORO-2-PHENYL- |
| CAS: | 2568-51-6 |
| EnglishSynonyms: | BUTTPARK 41\07-20 ; 4,6-DICHLORO-2-PHENYL-3(2H)-PYRIDAZINONE ; 3(2H)-PYRIDAZINONE, 4,6-DICHLORO-2-PHENYL- |
| pro_mdlNumber: | MFCD00814253 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | c1ccc(cc1)n2c(=O)c(cc(n2)Cl)Cl |
| InChi: | InChI=1S/C10H6Cl2N2O/c11-8-6-9(12)13-14(10(8)15)7-4-2-1-3-5-7/h1-6H |
| InChiKey: | InChIKey=SPBXHODOBMVHQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.