* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3-(3-BUTENYL)BENZOIC ACID |
| CAS: | 286933-10-6 |
| EnglishSynonyms: | 3-(3-BUTENYL)BENZOIC ACID ; 3-(BUT-3-EN-1-YL)BENZOIC ACID |
| pro_mdlNumber: | MFCD02259918 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C=CCCc1cccc(c1)C(=O)O |
| InChi: | InChI=1S/C11H12O2/c1-2-3-5-9-6-4-7-10(8-9)11(12)13/h2,4,6-8H,1,3,5H2,(H,12,13) |
| InChiKey: | InChIKey=RIBHGSBRURDWDC-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.