* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | NAPHTHALENE-1,2,3,4,9,10-13C6 |
| CAS: | 287399-34-2 |
| EnglishSynonyms: | NAPHTHALENE-1,2,3,4,9,10-13C6 ; NAPHTHALENE (13C6) |
| pro_mdlNumber: | MFCD01075601 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | c1cc[13c]2[13cH][13cH][13cH][13cH][13c]2c1 |
| InChi: | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,5+1,6+1,9+1,10+1 |
| InChiKey: | InChIKey=UFWIBTONFRDIAS-TUSAXXEXSA-N |
|
|
| MeltingPoint: | 80-82 DEG C(LIT) |
| Boiling_Point: | 218 DEG C(LIT) |
| PhysicalProperty: | FLASHPOINT: 176 DEG F FLASHPOINT: 80 DEG C |
| Comments: | MASS SHIFT: M+6 RIDADR: UN 1334 4.1/PG 3 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 134.12 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.