* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | CYTOSINE-1,3-15N2 |
| CAS: | 287484-45-1 |
| EnglishSynonyms: | CYTOSINE-1,3-15N2 |
| pro_mdlNumber: | MFCD00144033 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1c[15nH]c(=O)[15n]c1N |
| InChi: | InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)/i6+1,7+1 |
| InChiKey: | InChIKey=OPTASPLRGRRNAP-AKZCFXPHSA-N |
|
|
| MeltingPoint: | >300 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+2 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 113.05 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.