* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PICRASIN B ACETATE |
| CAS: | 30315-04-9 |
| EnglishSynonyms: | PICRASIN B ACETATE |
| pro_mdlNumber: | MFCD17214891 |
| pro_acceptors: | 7 |
| pro_donors: | 0 |
| pro_smile: | C[C@@H]1C[C@@H](C(=O)[C@]2([C@H]1CC3[C@@]4([C@@H]2C(=O)C(=C([C@@H]4CC(=O)O3)C)OC)C)C)OC(=O)C |
| InChi: | InChI=1S/C23H30O7/c1-10-7-15(29-12(3)24)21(27)23(5)13(10)8-16-22(4)14(9-17(25)30-16)11(2)19(28-6)18(26)20(22)23/h10,13-16,20H,7-9H2,1-6H3/t10-,13+,14+,15+,16?,20+,22-,23+/m1/s1 |
| InChiKey: | InChIKey=XWNXCBLGFWPHOO-LKRMDRTQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.