* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHYL 2-(5,6-DIHYDROIMIDAZO[2,1-B][1,3]THIAZOL-2-YL)ACETATE |
| CAS: | 329695-32-1 |
| EnglishSynonyms: | ETHYL 2-(5H,6H-IMIDAZO[2,1-B][1,3]THIAZOL-2-YL)ACETATE ; ETHYL 2-(5,6-DIHYDROIMIDAZO[2,1-B][1,3]THIAZOL-2-YL)ACETATE |
| pro_mdlNumber: | MFCD02169479 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CCOC(=O)CC1=CN2CCN=C2S1 |
| InChi: | InChI=1S/C9H12N2O2S/c1-2-13-8(12)5-7-6-11-4-3-10-9(11)14-7/h6H,2-5H2,1H3 |
| InChiKey: | InChIKey=SSECOEWESJDVSJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.