* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9-OXODEC-2-ENOIC ACID |
| CAS: | 334-20-3 |
| EnglishSynonyms: | 9-OXO-2-DECENOIC ACID ; 9-OXODEC-2-ENOIC ACID ; (2E)-9-OXODEC-2-ENOIC ACID |
| pro_mdlNumber: | MFCD00204505 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC(=O)CCCCC/C=C/C(=O)O |
| InChi: | InChI=1S/C10H16O3/c1-9(11)7-5-3-2-4-6-8-10(12)13/h6,8H,2-5,7H2,1H3,(H,12,13)/b8-6+ |
| InChiKey: | InChIKey=INJRDZMWIAYEMM-SOFGYWHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.