* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 3-PHENYL-OXINDOLE |
CAS: | 3456-79-9 |
EnglishSynonyms: | 3-PHENYL-OXINDOLE ; 3-PHENYL-1,3-DIHYDRO-2H-INDOL-2-ONE |
pro_mdlNumber: | MFCD00158550 |
pro_acceptors: | 2 |
pro_donors: | 1 |
pro_smile: | c1ccc(cc1)C2c3ccccc3NC2=O |
InChi: | InChI=1S/C14H11NO/c16-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)15-14/h1-9,13H,(H,15,16) |
InChiKey: | InChIKey=PAMMIXSSIGTOAK-UHFFFAOYSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.