* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | BICYCLO[2.2.1]HEPT-2-YL ACETATE |
| CAS: | 34640-76-1 |
| EnglishSynonyms: | 2-NORBORNYL ACETATE ; BICYCLO[2.2.1]HEPT-2-YL ACETATE |
| pro_mdlNumber: | MFCD00029119 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CC(=O)OC1C[C@H]2CC[C@@H]1C2 |
| InChi: | InChI=1S/C9H14O2/c1-6(10)11-9-5-7-2-3-8(9)4-7/h7-9H,2-5H2,1H3/t7-,8+,9?/m0/s1 |
| InChiKey: | InChIKey=YXNICIBZSREEPY-ZQTLJVIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.