* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | LAMINARIBIOSE |
CAS: | 34980-39-7 |
EnglishSynonyms: | LAMINARIBIOSE ; BETA-D-GLC-(1->3)-D-GLC |
pro_mdlNumber: | MFCD00070172 |
pro_acceptors: | 11 |
pro_donors: | 8 |
pro_smile: | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
InChi: | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8-,9-,10+,11?,12+/m1/s1 |
InChiKey: | InChIKey=QIGJYVCQYDKYDW-LCOYTZNXSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.