* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | ALANINE BETA [1-14C] |
CAS: | 36724-63-7 |
EnglishSynonyms: | ALANINE BETA [1-14C] |
pro_mdlNumber: | MFCD00189500 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | C(CN)[14C](=O)O |
InChi: | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/i3+2 |
InChiKey: | InChIKey=UCMIRNVEIXFBKS-YZRHJBSPSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.