* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 2-PENTANONE, 5-AMINO- |
| CAS: | 3732-10-3 |
| EnglishSynonyms: | 2-PENTANONE, 5-AMINO- ; 5-AMINO-2-PENTANONE ; 5-AMINOPENTAN-2-ONE |
| pro_mdlNumber: | MFCD09923610 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(=O)CCCN |
| InChi: | InChI=1S/C5H11NO/c1-5(7)3-2-4-6/h2-4,6H2,1H3 |
| InChiKey: | InChIKey=VTHKLCWOLNQWHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.