* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 4-METHYL-4-PENTEN-2-ONE |
CAS: | 3744-02-3 |
EnglishSynonyms: | 4-PENTEN-2-ONE, 4-METHYL- ; 4-METHYL-4-PENTEN-2-ONE ; 4-METHYLPENT-4-EN-2-ONE |
pro_mdlNumber: | MFCD00071647 |
pro_acceptors: | 1 |
pro_donors: | 0 |
pro_smile: | CC(=C)CC(=O)C |
InChi: | InChI=1S/C6H10O/c1-5(2)4-6(3)7/h1,4H2,2-3H3 |
InChiKey: | InChIKey=VADUDTKCGJKNDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.