* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 2-METHYL-4-OCTANOL |
| CAS: | 40575-41-5 |
| EnglishSynonyms: | 2-METHYL-4-OCTANOL ; 2-METHYLOCTAN-4-OL |
| pro_mdlNumber: | MFCD00039625 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCCCC(CC(C)C)O |
| InChi: | InChI=1S/C9H20O/c1-4-5-6-9(10)7-8(2)3/h8-10H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=BIAVIOIDPRPYJK-UHFFFAOYSA-N |
|
|
| Boiling_Point: | 872 DEG C |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.