* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-PROLINE, 5-PHENYL-, METHYL ESTER, (5R)- |
| CAS: | 434326-93-9 |
| EnglishSynonyms: | D-PROLINE, 5-PHENYL-, METHYL ESTER, (5R)- |
| pro_mdlNumber: | MFCD15071976 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)[C@H]1CC[C@@H](N1)c2ccccc2 |
| InChi: | InChI=1S/C12H15NO2/c1-15-12(14)11-8-7-10(13-11)9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3/t10-,11-/m1/s1 |
| InChiKey: | InChIKey=PLTYXWQEMLQCPO-GHMZBOCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.