* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | INDOLE-3-ACETIC ACID-CARBOXY-14C |
| CAS: | 4384-79-6 |
| EnglishSynonyms: | INDOLE-3-ACETIC ACID, [1-14C] ; INDOLE-3-ACETIC ACID-CARBOXY-14C |
| pro_mdlNumber: | MFCD00079389 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1ccc2c(c1)c(c[nH]2)C[14C](=O)O |
| InChi: | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i10+2 |
| InChiKey: | InChIKey=SEOVTRFCIGRIMH-HRVHXUPCSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.