* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ALLYL MYRISTATE |
| CAS: | 45236-96-2 |
| EnglishSynonyms: | ALLYL MYRISTATE |
| pro_mdlNumber: | MFCD00048457 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCCCCCCCCCCCCC(=O)OCC=C |
| InChi: | InChI=1S/C17H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16-4-2/h4H,2-3,5-16H2,1H3 |
| InChiKey: | InChIKey=FFXFQWSEFSLIKK-UHFFFAOYSA-N |
|
|
| MeltingPoint: | MP 106-108 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.