* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIETHYL MALONATE-1,2-13C2 |
| CAS: | 53051-82-4 |
| EnglishSynonyms: | DIETHYL MALONATE-1,2-13C2 |
| pro_mdlNumber: | MFCD15144826 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CCOC(=O)[13CH2][13C](=O)OCC |
| InChi: | InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3/i5+1,6+1 |
| InChiKey: | InChIKey=IYXGSMUGOJNHAZ-MPOCSFTDSA-N |
|
|
| Boiling_Point: | 199 DEG C |
| Density: | DENSITY: 1.068 G/ML AT 25 DEG C |
| Comments: | MASS SHIFT: M+2 WGK: 2 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 162.13 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.