* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 1H-INDOLE-2-CARBOXYLIC ACID, 2,3,4,5,6,7-HEXAHYDRO-, (2S)- |
CAS: | 537014-85-0 |
EnglishSynonyms: | 1H-INDOLE-2-CARBOXYLIC ACID, 2,3,4,5,6,7-HEXAHYDRO-, (2S)- |
pro_mdlNumber: | MFCD18834386 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | C1CCC2=C(C1)C[C@H](N2)C(=O)O |
InChi: | InChI=1S/C9H13NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h8,10H,1-5H2,(H,11,12)/t8-/m0/s1 |
InChiKey: | InChIKey=DAYHIOWULIYLFZ-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.