* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHYL 3-BUTYNOATE |
| CAS: | 53841-07-9 |
| EnglishSynonyms: | ETHYL BUT-3-YNOATE ; ETHYL 3-BUTYNOATE |
| pro_mdlNumber: | MFCD07780250 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCOC(=O)CC#C |
| InChi: | InChI=1S/C6H8O2/c1-3-5-6(7)8-4-2/h1H,4-5H2,2H3 |
| InChiKey: | InChIKey=YUIKUBSCWKOQKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.