* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3-(4-AMINOPHENOXY)BENZOIC ACID |
| CAS: | 54579-63-4 |
| EnglishSynonyms: | 3-(4-AMINOPHENOXY)BENZOIC ACID |
| pro_mdlNumber: | MFCD09035494 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1cc(cc(c1)Oc2ccc(cc2)N)C(=O)O |
| InChi: | InChI=1S/C13H11NO3/c14-10-4-6-11(7-5-10)17-12-3-1-2-9(8-12)13(15)16/h1-8H,14H2,(H,15,16) |
| InChiKey: | InChIKey=ZIKOFLSRJZCPKF-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.