* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | ETHANONE, 1-(1,3-DIMETHYL-2-AZIRIDINYL)-, TRANS- |
CAS: | 54595-22-1 |
EnglishSynonyms: | ETHANONE, 1-(1,3-DIMETHYL-2-AZIRIDINYL)-, TRANS- |
pro_mdlNumber: | MFCD18834719 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | C[C@@H]1[C@H](N1C)C(=O)C |
InChi: | InChI=1S/C6H11NO/c1-4-6(5(2)8)7(4)3/h4,6H,1-3H3/t4-,6+,7?/m1/s1 |
InChiKey: | InChIKey=HDRUNJKYINELQG-NKCGXFSVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.