* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 2-(3-NITROPHENYL)-1,3,4-OXADIAZOLE |
| CAS: | 5565-72-0 |
| EnglishSynonyms: | BUTTPARK 145\50-56 ; 2-(3-NITROPHENYL)-1,3,4-OXADIAZOLE ; 1,3,4-OXADIAZOLE, 2-(3-NITROPHENYL)- |
| pro_mdlNumber: | MFCD00085145 |
| pro_acceptors: | 6 |
| pro_donors: | 0 |
| pro_smile: | c1cc(cc(c1)[N+](=O)[O-])c2nnco2 |
| InChi: | InChI=1S/C8H5N3O3/c12-11(13)7-3-1-2-6(4-7)8-10-9-5-14-8/h1-5H |
| InChiKey: | InChIKey=NSIRBOSXFXTYQL-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.