* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | (3BETA)-3-HYDROXY-OLEAN-18-EN-28-OIC ACID |
| CAS: | 559-68-2 |
| EnglishSynonyms: | OLEAN-18-EN-28-OIC ACID, 3-HYDROXY-, (3B)- ; (3BETA)-3-HYDROXY-OLEAN-18-EN-28-OIC ACID ; OLEAN-18-EN-28-OIC ACID,3-HYDROXY-,(3BETA)- ; MOROLIC ACID |
| pro_mdlNumber: | MFCD11113465 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC1(CC[C@@]2(CC[C@@]3([C@@H](C2=C1)CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)C)C(=O)O)C |
| InChi: | InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-23,31H,8-17H2,1-7H3,(H,32,33)/t19-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
| InChiKey: | InChIKey=RGZSSKBTFGNUCG-VNTGHVHSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.