* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 1H-INDEN-1-OL, 2,3-DIHYDRO-4-NITRO- |
CAS: | 56124-60-8 |
EnglishSynonyms: | 4-NITRO-2,3-DIHYDRO-1H-INDEN-1-OL ; 2,3-DIHYDRO-4-NITRO-1H-INDEN-1-OL ; 1H-INDEN-1-OL, 2,3-DIHYDRO-4-NITRO- |
pro_mdlNumber: | MFCD18207620 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | c1cc2c(c(c1)[N+](=O)[O-])CCC2O |
InChi: | InChI=1S/C9H9NO3/c11-9-5-4-6-7(9)2-1-3-8(6)10(12)13/h1-3,9,11H,4-5H2 |
InChiKey: | InChIKey=LZMRRYRIKGREQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.