* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 2-IODO-6-METHOXYPYRAZINE |
CAS: | 58139-03-0 |
EnglishSynonyms: | 2-IODO-6-METHOXYPYRAZINE |
pro_mdlNumber: | MFCD09265494 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | COc1cncc(n1)I |
InChi: | InChI=1S/C5H5IN2O/c1-9-5-3-7-2-4(6)8-5/h2-3H,1H3 |
InChiKey: | InChIKey=NSZWVUZALRZRLQ-UHFFFAOYSA-N |
|
|
MeltingPoint: | 36.6-38.1 DEG C |
PhysicalProperty: | FLASHPOINT: >110 DEG C FLASHPOINT: >230 DEG F |
Comments: | WGK: 3 |
|
|
secure_symbol: |
![]() ![]() |
secure_signal_word: | Danger |
secure_risk_stmt: | H302-H315-H318-H335 |
secure_cautionary_stmt: | P261-P280-P305 + P351 + P338 |
secure_damage_code: | Xn |
secure_risk_disclosure_stmt: | R:10-22-37/38-41 |
secure_security_stmt: | S:16-26-37 |
secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.