* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | 3-BUTYN-2-OL, 4-(3-BROMOPHENYL)- |
CAS: | 591218-71-2 |
EnglishSynonyms: | 3-BUTYN-2-OL, 4-(3-BROMOPHENYL)- ; 4-(3-BROMOPHENYL)BUT-3-YN-2-OL ; 4-(3-BROMOPHENYL)-3-BUTYN-2-OL |
pro_mdlNumber: | MFCD06803783 |
pro_acceptors: | 1 |
pro_donors: | 1 |
pro_smile: | CC(C#Cc1cccc(c1)Br)O |
InChi: | InChI=1S/C10H9BrO/c1-8(12)5-6-9-3-2-4-10(11)7-9/h2-4,7-8,12H,1H3 |
InChiKey: | InChIKey=IIQCJKMKWGNWDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.