* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ORASOL NAVY BLUE 2RB |
| CAS: | 61969-42-4 |
| EnglishSynonyms: | ORASOL NAVY BLUE 2RB |
| pro_mdlNumber: | MFCD01747715 |
| pro_acceptors: | 14 |
| pro_donors: | 2 |
| pro_smile: | c1cc2c(ccc(c2O[Co]Oc3c4cccc(c4ccc3/N=N/c5ccc(cc5O)[N+](=O)[O-])Cl)/N=N/c6ccc(cc6O)[N+](=O)[O-])c(c1)Cl |
| InChi: | InChI=1S/2C16H10ClN3O4.Co/c2*17-12-3-1-2-11-10(12)5-7-14(16(11)22)19-18-13-6-4-9(20(23)24)8-15(13)21;/h2*1-8,21-22H;/q;;+2/p-2/b2*19-18+; |
| InChiKey: | InChIKey=OEUCVSHLNQHHCM-VFUQPONKSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.