* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ISOBUTYRIC ACID-1-13C |
| CAS: | 6228-78-0 |
| EnglishSynonyms: | 2-METHYLPROPIONIC ACID-1-13C ; ISOBUTYRIC ACID-1-13C |
| pro_mdlNumber: | MFCD00673661 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(C)[13C](=O)O |
| InChi: | InChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)/i4+1 |
| InChiKey: | InChIKey=KQNPFQTWMSNSAP-AZXPZELESA-N |
|
|
| MeltingPoint: | -47 DEG C(LIT) |
| Boiling_Point: | 153-154 DEG C(LIT) |
| Density: | DENSITY: 0.95 G/ML AT 25 DEG C |
| Comments: | MASS SHIFT: M+1 RIDADR: UN 2529 3/PG 3 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 89.10 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.