* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-ALA(2),MEPHE(4),MET(0)-OL-ENKEPHALIN |
| CAS: | 64854-64-4 |
| EnglishSynonyms: | FK 33-824 ; DAMME ; H-TYR-D-ALA-GLY-N-ME-PHE-METHIONIN(O)-OL ; D-ALA(2),MEPHE(4),MET(0)-OL-ENKEPHALIN |
| pro_mdlNumber: | MFCD00076420 |
| pro_acceptors: | 12 |
| pro_donors: | 6 |
| pro_smile: | C[C@H](C(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)C)CO)NC(=O)[C@H](Cc2ccc(cc2)O)N |
| InChi: | InChI=1S/C29H41N5O7S/c1-19(32-28(39)24(30)15-21-9-11-23(36)12-10-21)27(38)31-17-26(37)34(2)25(16-20-7-5-4-6-8-20)29(40)33-22(18-35)13-14-42(3)41/h4-12,19,22,24-25,35-36H,13-18,30H2,1-3H3,(H,31,38)(H,32,39)(H,33,40)/t19-,22+,24+,25+,42?/m1/s1 |
| InChiKey: | InChIKey=HYZHONGSQNXMPH-IQNHEXCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.